![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ibm-logo.gif | 2014-07-24 08:36 | 430 | |
| htaccess.txt | 2014-07-24 08:36 | 60 | |
| godaddy.mw.pdf | 2014-07-24 08:36 | 91K | |
| fred-aftld.pdf | 2014-07-24 08:36 | 136K | |
| file___C__Documents ..> | 2014-07-24 08:36 | 53K | |
| fidelityinvestments...> | 2014-07-24 08:36 | 90K | |
| fidelityinvestments...> | 2014-07-24 08:36 | 91K | |
| fidelityinternationa..> | 2014-07-24 08:36 | 90K | |
| fidelityinternationa..> | 2014-07-24 08:36 | 90K | |
| fidelity.com.mw.pdf | 2014-07-24 08:36 | 90K | |
| fidelity.co.mw.pdf | 2014-07-24 08:36 | 91K | |
| expression-of-intere..> | 2014-07-24 08:36 | 8.4M | |
| domain name service ..> | 2014-07-24 08:36 | 92K | |
| dedzacadeco.txt | 2014-07-24 08:36 | 31 | |
| configuration tutori..> | 2014-07-24 08:36 | 1.2K | |
| cadeco2010/ | 2014-07-24 08:36 | - | |
| cadeco/ | 2014-07-24 08:36 | - | |
| cadeco-sept/ | 2014-07-24 08:36 | - | |
| cadeco-old/ | 2014-07-24 08:36 | - | |
| cadeco-old.zip | 2014-07-24 08:36 | 761K | |
| balance.pdf | 2014-07-24 08:36 | 9.8K | |
| backup script.txt | 2014-07-24 08:36 | 920 | |
| backup script-to-tap..> | 2014-07-24 08:36 | 7.0K | |
| backup notes/ | 2014-07-24 08:36 | - | |
| askToolbarInstaller-..> | 2014-07-24 08:36 | 2.8M | |
| ascio.exel.txt | 2014-07-24 08:36 | 1.3K | |
| afnog.txt | 2014-07-24 08:36 | 548 | |
| abou flametours/ | 2014-07-24 08:36 | - | |
| Joomla_1.5.18-Stable..> | 2014-07-24 08:36 | 4.5M | |
| Help and Support.lnk | 2014-07-24 08:36 | 800 | |
| GreeningIT_Workshop_..> | 2014-07-24 08:36 | 56K | |
| Google.lnk | 2014-07-24 08:36 | 2.0K | |
| Free Easy Burner.lnk | 2014-07-24 08:36 | 768 | |
| Errors.doc | 2014-07-24 08:36 | 64K | |
| Edu-index.html | 2014-07-24 08:36 | 4.2K | |
| Eating Fruit on an e..> | 2014-07-24 08:36 | 48K | |
| DiG HOWTO.pdf | 2014-07-24 08:36 | 265K | |
| DVDVideoSoft Free St..> | 2014-07-24 08:36 | 892 | |
| DNS HOWTO.htm | 2014-07-24 08:36 | 4.1K | |
| Chapter 6 DNS Sample..> | 2014-07-24 08:36 | - | |
| Chapter 6 DNS Sample..> | 2014-07-24 08:36 | 76K | |
| CARI29VR.25&id=780e2..> | 2014-07-24 08:36 | 8.7M | |
| Book1.xls | 2014-07-24 08:36 | 17K | |
| BlueVoda Website Bui..> | 2014-07-24 08:36 | 1.7K | |
| Bible_King_James_Ver..> | 2014-07-24 08:36 | 8.9M | |
| AfNOG offer of partc..> | 2014-07-24 08:36 | 275K | |
| Advert-mzuni-System-..> | 2014-07-24 08:36 | 261K | |
| 2010-verizon.net.mw-..> | 2014-07-24 08:36 | 19K | |
| 05 august meeting.doc | 2014-07-24 08:36 | 52K | |
| (ebook) Linux Shell ..> | 2014-07-24 08:36 | 170K | |